CAS 861407-95-6

2-amino-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile

Description:

2-amino-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile is a chemical compound characterized by its unique structure, which includes a thiophene ring, an amino group, and a cyano group. The presence of the 3,4-dichlorophenyl substituent contributes to its potential biological activity and lipophilicity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties. The presence of both electron-withdrawing (cyano and chloro groups) and electron-donating (amino group) functionalities can influence its reactivity and interaction with biological targets. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. As with many thiophene derivatives, it may also exhibit interesting electronic properties, making it a candidate for use in organic electronics or materials science. Safety and handling precautions should be observed due to the presence of halogenated components.

Formula: C₁₁H₆Cl₂N₂S

InChI: InChI=1/C11H6Cl2N2S/c12-9-2-1-6(3-10(9)13)8-5-16-11(15)7(8)4-14/h1-3,5H,15H2

SMILES: c1cc(c(cc1c1csc(c1C#N)N)Cl)Cl

Synonyms:

• 3-Thiophenecarbonitrile, 2-Amino-4-(3,4-Dichlorophenyl)-

2-Amino-4-(3,4-dichlorophenyl)thiophene-3-carbonitrile

CAS: 861407-95-6

Formula: C₁₁H₆Cl₂N₂S

Molecular weight: 269.1497

Ref: IN-DA004OST