CAS 861408-36-8

5-[(2-chloro-5-methylphenoxy)methyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[(2-chloro-5-methylphenoxy)methyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with CAS number 861408-36-8, is a chemical compound characterized by its triazole core, which is a five-membered ring containing three nitrogen atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The presence of a chloro-substituted phenyl group enhances its lipophilicity, which may influence its interaction with biological targets. The methyl groups attached to the triazole ring and the phenoxy moiety can affect the compound's steric and electronic properties, potentially impacting its solubility and stability. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its structural complexity suggests potential applications in agrochemicals or pharmaceuticals, although specific biological activities would require further investigation through empirical studies.

Formula: C₁₁H₁₂ClN₃OS

InChI: InChI=1/C11H12ClN3OS/c1-7-3-4-8(12)9(5-7)16-6-10-13-14-11(17)15(10)2/h3-5H,6H2,1-2H3,(H,14,17)

SMILES: Cc1ccc(c(c1)OCc1nnc(n1C)S)Cl

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-[(2-chloro-5-methylphenoxy)methyl]-4-methyl-

5-[(2-Chloro-5-methylphenoxy)methyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 861408-36-8

Formula: C₁₁H₁₂ClN₃OS

Molecular weight: 269.7505

Ref: IN-DA00GTSW

5-[(2-chloro-5-methylphenoxy)methyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 861408-36-8

Formula: C₁₁H₁₂ClN₃OS

Purity: 95.0%

Molecular weight: 269.75

Ref: 10-F307749