CAS 861408-82-4

2-amino-5-methyl-4-[4-(2-methylpropyl)phenyl]thiophene-3-carbonitrile

Description:

2-amino-5-methyl-4-[4-(2-methylpropyl)phenyl]thiophene-3-carbonitrile, with the CAS number 861408-82-4, is a synthetic organic compound characterized by its complex structure that includes a thiophene ring, an amino group, and a carbonitrile functional group. This compound features a branched alkyl substituent (2-methylpropyl) and a phenyl group, contributing to its potential hydrophobic properties. The presence of the amino group suggests that it may exhibit basic characteristics, while the carbonitrile group can impart polarity and reactivity, making it suitable for various chemical reactions. The thiophene moiety is known for its aromatic properties and can participate in π-π stacking interactions, which may influence the compound's solubility and stability. Overall, this compound may have applications in pharmaceuticals, materials science, or organic electronics, depending on its specific properties and reactivity, which can be further explored through experimental studies.

Formula: C₁₆H₁₈N₂S

InChI: InChI=1/C16H18N2S/c1-10(2)8-12-4-6-13(7-5-12)15-11(3)19-16(18)14(15)9-17/h4-7,10H,8,18H2,1-3H3

SMILES: CC(C)Cc1ccc(cc1)c1c(C)sc(c1C#N)N

2-amino-4-(4-isobutylphenyl)-5-methylthiophene-3-carbonitrile

CAS: 861408-82-4

Formula: C₁₆H₁₈N₂S

Purity: 95.0%

Molecular weight: 270.39

Ref: 10-F307643