CAS 861412-41-1

6-Ethyl-2-(4-methoxyphenyl)-4-quinolinecarboxylic acid

Description:

6-Ethyl-2-(4-methoxyphenyl)-4-quinolinecarboxylic acid is a synthetic organic compound characterized by its quinoline core, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. This compound features an ethyl group at the 6-position and a para-methoxyphenyl group at the 2-position, contributing to its unique chemical properties and potential biological activity. The carboxylic acid functional group at the 4-position enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. The presence of the methoxy group can also affect the compound's electronic properties and steric hindrance, potentially impacting its pharmacological profile. This compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the fields of anti-inflammatory or anticancer research, although specific biological activities would require further investigation. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature.

Formula: C₁₉H₁₇NO₃

InChI: InChI=1S/C19H17NO3/c1-3-12-4-9-17-15(10-12)16(19(21)22)11-18(20-17)13-5-7-14(23-2)8-6-13/h4-11H,3H2,1-2H3,(H,21,22)

InChI key: InChIKey=HVBSFINYLDLHJC-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C1)C3=CC=C(OC)C=C3)C=CC(CC)=C2

Synonyms:

• 6-Ethyl-2-(4-methoxyphenyl)-4-quinolinecarboxylic acid
• 4-Quinolinecarboxylic acid, 6-ethyl-2-(4-methoxyphenyl)-