CAS 861440-89-3
:2-Hydrazinyl-4-(3-methoxyphenyl)-6-(trifluoromethyl)pyrimidine
Description:
2-Hydrazinyl-4-(3-methoxyphenyl)-6-(trifluoromethyl)pyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms. The presence of a hydrazinyl group (-NH-NH2) at the 2-position contributes to its potential reactivity, particularly in forming hydrazones or participating in condensation reactions. The 4-position features a 3-methoxyphenyl substituent, which can enhance the compound's lipophilicity and influence its biological activity. Additionally, the trifluoromethyl group (-CF3) at the 6-position is known for its electron-withdrawing properties, which can significantly affect the compound's electronic characteristics and stability. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its unique structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential uses.
Formula:C12H11F3N4O
InChI:InChI=1S/C12H11F3N4O/c1-20-8-4-2-3-7(5-8)9-6-10(12(13,14)15)18-11(17-9)19-16/h2-6H,16H2,1H3,(H,17,18,19)
InChI key:InChIKey=RVZKOHMBDFSMSH-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(NC(=NN)N1)C2=CC(OC)=CC=C2
Synonyms:- 2-Hydrazinyl-4-(3-methoxyphenyl)-6-(trifluoromethyl)pyrimidine
- Pyrimidine, 2-hydrazinyl-4-(3-methoxyphenyl)-6-(trifluoromethyl)-
- 2(1H)-Pyrimidinone, 4-(3-methoxyphenyl)-6-(trifluoromethyl)-, hydrazone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.