CAS 861451-49-2
:2-amino-4-(4-tert-butylphenyl)-5-methylthiophene-3-carboxamide
Description:
2-amino-4-(4-tert-butylphenyl)-5-methylthiophene-3-carboxamide is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features an amino group (-NH2) and a carboxamide group (-C(=O)NH2), contributing to its potential as a bioactive molecule. The presence of a tert-butyl group on the phenyl ring enhances its lipophilicity, which may influence its solubility and biological activity. The methylthio group at the 5-position of the thiophene ring can also affect the compound's electronic properties and reactivity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its unique structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. As with many organic compounds, its stability, reactivity, and interactions with biological systems would depend on various factors, including pH, temperature, and the presence of other chemical species.
Formula:C16H20N2OS
InChI:InChI=1/C16H20N2OS/c1-9-12(13(14(17)19)15(18)20-9)10-5-7-11(8-6-10)16(2,3)4/h5-8H,18H2,1-4H3,(H2,17,19)
SMILES:Cc1c(c2ccc(cc2)C(C)(C)C)c(C(=O)N)c(N)s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.