CymitQuimica logo

CAS 861453-64-7

:

6-Ethyl-2-(3-methylphenyl)-4-quinolinecarboxylic acid

Description:
6-Ethyl-2-(3-methylphenyl)-4-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This compound features an ethyl group and a 3-methylphenyl substituent, contributing to its unique properties and potential applications. The presence of the carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions and may exhibit acidic behavior. The molecular structure suggests that it may possess biological activity, potentially acting as a ligand or inhibitor in various biochemical pathways. Its solubility, stability, and reactivity can be influenced by the substituents on the quinoline ring, making it of interest in medicinal chemistry and drug development. Additionally, the compound's specific interactions with biological targets could be explored for therapeutic applications. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C19H17NO2
InChI:InChI=1S/C19H17NO2/c1-3-13-7-8-17-15(10-13)16(19(21)22)11-18(20-17)14-6-4-5-12(2)9-14/h4-11H,3H2,1-2H3,(H,21,22)
InChI key:InChIKey=SPEOJPZKAYDZNZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C(C1)C3=CC(C)=CC=C3)C=CC(CC)=C2
Synonyms:
  • 4-Quinolinecarboxylic acid, 6-ethyl-2-(3-methylphenyl)-
  • 6-Ethyl-2-(3-methylphenyl)-4-quinolinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.