CAS 861586-13-2

Tetrahydro-2,6-dimethyl-2H-pyran-4-carboxamide

Description:

Tetrahydro-2,6-dimethyl-2H-pyran-4-carboxamide is a chemical compound characterized by its unique structure, which includes a pyran ring and an amide functional group. This compound features a tetrahydrofuran-like structure, indicating it is a saturated cyclic ether with additional methyl groups at the 2 and 6 positions, contributing to its stability and potentially influencing its reactivity. The presence of the carboxamide group suggests that it can participate in hydrogen bonding, which may enhance its solubility in polar solvents. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its molecular properties, such as boiling point, melting point, and solubility, would depend on the specific interactions of its functional groups. Additionally, the compound's CAS number, 861586-13-2, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and organic synthesis. Overall, Tetrahydro-2,6-dimethyl-2H-pyran-4-carboxamide represents a versatile structure with potential utility in various chemical applications.

Formula: C₈H₁₅NO₂

InChI: InChI=1S/C8H15NO2/c1-5-3-7(8(9)10)4-6(2)11-5/h5-7H,3-4H2,1-2H3,(H2,9,10)

InChI key: InChIKey=YCPISZGBSQGAQM-UHFFFAOYSA-N

SMILES: C(N)(=O)C1CC(C)OC(C)C1

Synonyms:

• 2H-Pyran-4-carboxamide, tetrahydro-2,6-dimethyl-
• 2,6-Dimethyloxane-4-carboxamide
• 4-Pyrancarboxamide, tetrahydro-2,6-dimethyl-
• Tetrahydro-2,6-dimethyl-2H-pyran-4-carboxamide