CAS 86168-78-7
:sermorelin
Description:
Sermorelin, with the CAS number 86168-78-7, is a synthetic peptide that functions as a growth hormone-releasing hormone (GHRH) analog. It consists of 29 amino acids and is primarily used in clinical settings to stimulate the secretion of growth hormone from the pituitary gland. Sermorelin is characterized by its ability to enhance endogenous growth hormone production, making it a potential therapeutic option for conditions related to growth hormone deficiency. The peptide is typically administered via subcutaneous injection and has a relatively short half-life, necessitating multiple doses for sustained effects. Its mechanism of action involves binding to specific receptors on pituitary cells, leading to increased release of growth hormone. Sermorelin is often studied for its potential benefits in anti-aging therapies, muscle growth, and overall metabolic health. However, its use should be monitored by healthcare professionals due to possible side effects and the need for appropriate dosing. As with any peptide therapy, the regulatory status and clinical applications may vary by region.
Formula:C149H246N44O42S
InChI:InChI=1/C149H246N44O42S/c1-20-77(13)116(191-122(211)81(17)168-132(221)104(66-113(204)205)178-121(210)79(15)167-123(212)88(152)62-84-39-43-86(198)44-40-84)145(234)185-102(63-83-32-23-22-24-33-83)138(227)193-118(82(18)197)146(235)186-103(65-111(155)202)137(226)189-108(71-196)142(231)182-101(64-85-41-45-87(199)46-42-85)136(225)175-93(38-31-56-165-149(161)162)126(215)174-91(35-26-28-53-151)131(220)190-115(76(11)12)143(232)184-97(58-72(3)4)124(213)166-68-112(203)170-94(47-49-109(153)200)128(217)180-100(61-75(9)10)135(224)188-106(69-194)140(229)169-80(16)120(209)172-92(37-30-55-164-148(159)160)125(214)173-90(34-25-27-52-150)127(216)179-99(60-74(7)8)134(223)181-98(59-73(5)6)133(222)176-95(48-50-110(154)201)129(218)183-105(67-114(206)207)139(228)192-117(78(14)21-2)144(233)177-96(51-57-236-19)130(219)187-107(70-195)141(230)171-89(119(156)208)36-29-54-163-147(157)158/h22-24,32-33,39-46,72-82,88-108,115-118,194-199H,20-21,25-31,34-38,47-71,150-152H2,1-19H3,(H2,153,200)(H2,154,201)(H2,155,202)(H2,156,208)(H,166,213)(H,167,212)(H,168,221)(H,169,229)(H,170,203)(H,171,230)(H,172,209)(H,173,214)(H,174,215)(H,175,225)(H,176,222)(H,177,233)(H,178,210)(H,179,216)(H,180,217)(H,181,223)(H,182,231)(H,183,218)(H,184,232)(H,185,234)(H,186,235)(H,187,219)(H,188,224)(H,189,226)(H,190,220)(H,191,211)(H,192,228)(H,193,227)(H,204,205)(H,206,207)(H4,157,158,163)(H4,159,160,164)(H4,161,162,165)
Synonyms:- GRF (1-29) amide (human)
- H-Tyr-Ala-Asp-Ala-Ile-Phe-Thr-Asn-Ser-Tyr-Arg-Lys-Val-Leu-Gly-Gln-Leu-Ser-Ala-Arg-Lys-Leu-Leu-Gln-Asp-Ile-Met-Ser-Arg-NH2
- growth hormone releasing factor*fragment 1-29 ami
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Growth Hormone Releasing Factor (GRF) (1-29) amide, human
CAS:Growth Hormone Releasing Factor (GRF) (1-29) amide, humanFormula:C149H246N44O42SMolecular weight:3357.9GRF (1-29) amide (human)
CAS:GRF (1-29) amide (sermorelin) is the shortest GRF fragment with full biological activity. CAS Number (sermorelin acetate): 114466-38-5.Formula:C149H246N44O42SPurity:97.6%Color and Shape:White PowderMolecular weight:3357.93Sermorelin acetate
CAS:Formula:C151H250N44O44SPurity:(HPLC) ≥ 99.0%Color and Shape:White to off-white solidMolecular weight:3417.99GRF (1-29) amide (human) acetate salt
CAS:Growth hormone-releasing factor (GRF) is a peptide fragment of amino acids 1–2 from GHRH (growth hormone-releasing hormone). This 1-29 region is the shortest fully functional fragment of GHRH. GRF is also known as sermorelin. Sermorelin binds to the growth hormone-releasing hormone receptor (GHRH-R), and acts as a surrogate for GHRH, causing growth hormone secretion.human: H-YADAIFTNSYRKVLGQLSARKLLQDIMSR-NH2rat: H-HADAIFTSSYRR I LGQLYARKLLHEIMNR-NH2Formula:C149H246N44O42SPurity:Min. 95%Molecular weight:3,357.88 g/mol



