CAS 86176-56-9

4-chloro-2-(5-isoxazolyl)phenol

Description:

4-Chloro-2-(5-isoxazolyl)phenol is an organic compound characterized by its phenolic structure, which includes a chlorine substituent and an isoxazole ring. The presence of the chlorine atom at the para position relative to the hydroxyl group contributes to its chemical reactivity and potential biological activity. The isoxazole moiety, a five-membered heterocyclic compound containing nitrogen and oxygen, enhances the compound's properties, making it of interest in medicinal chemistry and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical behavior can be influenced by the functional groups present, allowing for various reactions such as nucleophilic substitutions or electrophilic aromatic substitutions. Additionally, 4-chloro-2-(5-isoxazolyl)phenol may possess antimicrobial or antifungal properties, making it a candidate for further research in pharmacology. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₉H₆ClNO₂

InChI: InChI=1/C9H6ClNO2/c10-6-1-2-8(12)7(5-6)9-3-4-11-13-9/h1-5,12H

SMILES: c1cc(c(cc1Cl)c1ccno1)O

Synonyms:

• 4-Chloro-2-(1,2-Oxazol-5-Yl)Phenol

4-Chloro-2-(5-isoxazolyl)phenol

CAS: 86176-56-9

Formula: C₉H₆ClNO₂

Molecular weight: 195.6024

Ref: IN-DA003L27

4-Chloro-2-(5-isoxazolyl)phenol

CAS: 86176-56-9

4-Chloro-2-(5-isoxazolyl)phenol

Purity: 97%

Color and Shape: Solid

Molecular weight: 195.60g/mol

Ref: 54-OR917483

5-(5'-Chloro-2'-hydroxyphenyl)-isoxazole

CAS: 86176-56-9

5-(5'-Chloro-2'-hydroxyphenyl)-isoxazole is a fine chemical that can be used as a versatile building block in organic synthesis. It is also a useful intermediate and research chemical. 5-(5'-Chloro-2'-hydroxyphenyl)-isoxazole has been shown to react with various reagents and has been used as an intermediate for the synthesis of other compounds. This compound can be used as a speciality chemical or as a reagent in laboratory reactions.

Formula: C₉H₆ClNO₂

Purity: Min. 95%

Color and Shape: Solid

Molecular weight: 195.6 g/mol

Ref: 3D-FC65973