CymitQuimica logo

CAS 86178-21-4

:

ethyl 3-(1,3-dioxan-2-yl)propanoate

Description:
Ethyl 3-(1,3-dioxan-2-yl)propanoate, identified by its CAS number 86178-21-4, is an organic compound characterized by its ester functional group. This substance features a propanoate moiety linked to a 1,3-dioxane ring, which contributes to its unique chemical properties. The presence of the dioxane ring imparts a degree of stability and can influence the compound's solubility and reactivity. Ethyl 3-(1,3-dioxan-2-yl)propanoate is typically a colorless to pale yellow liquid with a pleasant odor, making it potentially useful in flavor and fragrance applications. Its molecular structure suggests it may exhibit moderate polarity, allowing it to dissolve in various organic solvents while being less soluble in water. Additionally, the compound may participate in typical ester reactions, such as hydrolysis and transesterification, under appropriate conditions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H16O4
InChI:InChI=1/C9H16O4/c1-2-11-8(10)4-5-9-12-6-3-7-13-9/h9H,2-7H2,1H3
SMILES:CCOC(=O)CCC1OCCCO1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.