
CAS 861803-78-3
:1H-Indazole, 3-bromo-1,5-dimethyl-
Description:
1H-Indazole, 3-bromo-1,5-dimethyl- is a heterocyclic organic compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. The presence of bromine at the 3-position and two methyl groups at the 1 and 5 positions contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic methyl groups. Its structure allows for potential reactivity in various chemical reactions, including electrophilic substitutions and coupling reactions, making it of interest in medicinal chemistry and material science. The bromine substituent can serve as a useful handle for further functionalization, enhancing its utility in synthetic applications. Additionally, compounds like this may exhibit biological activity, which can be explored in drug discovery and development. Overall, 1H-Indazole, 3-bromo-1,5-dimethyl- is a versatile compound with potential applications in various fields of chemistry.
Formula:C9H9BrN2
InChI:InChI=1S/C9H9BrN2/c1-6-3-4-8-7(5-6)9(10)11-12(8)2/h3-5H,1-2H3
InChI key:InChIKey=JYPWTFQBPNNMON-UHFFFAOYSA-N
SMILES:BrC=1C=2C(N(C)N1)=CC=C(C)C2
Synonyms:- 3-Bromo-1,5-dimethyl-1H-indazole
- Isoindazole, 3-bromo-1,5-dimethyl-
- 1H-Indazole, 3-bromo-1,5-dimethyl-
- 3-Bromo-1,5-dimethylindazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.