CAS 861819-28-5
:(2S,5R)-5-azido-4-benzyloxy-2,3-dimethoxy-6-methyl-tetrahydropyran
Description:
The chemical substance known as (2S,5R)-5-azido-4-benzyloxy-2,3-dimethoxy-6-methyl-tetrahydropyran, with the CAS number 861819-28-5, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features several functional groups, including an azido group (-N3), which is known for its reactivity and potential applications in click chemistry, and benzyloxy groups that enhance its solubility and reactivity. The presence of methoxy groups (-OCH3) contributes to its polar characteristics, while the methyl group adds to its hydrophobic nature. The specific stereochemistry indicated by the (2S,5R) configuration suggests that the compound has distinct spatial arrangements that can influence its biological activity and reactivity. Such compounds are often of interest in medicinal chemistry and synthetic organic chemistry due to their potential utility in drug development and as intermediates in the synthesis of more complex molecules.
Formula:C15H21N3O4
InChI:InChI=1/C15H21N3O4/c1-10-12(17-18-16)13(14(19-2)15(20-3)22-10)21-9-11-7-5-4-6-8-11/h4-8,10,12-15H,9H2,1-3H3/t10?,12-,13?,14?,15+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 4-Azido-4,6-dideoxy-2-O-methyl-3-O-benzyl-alpha-D-glucopyranoside
CAS:Controlled ProductApplications Methyl 4-Azido-4,6-dideoxy-2-O-methyl-3-O-benzyl-α-D-glucopyranoside (cas# 861819-28-5) is a compound useful in organic synthesis.
Formula:C15H21N3O4Color and Shape:YellowMolecular weight:307.34Methyl 4-azido-3-O-benzyl-4,6-dideoxy-2-O-methyl-a-D-glucopyranoside
CAS:Methyl 4-azido-3-O-benzyl-4,6-dideoxy-2-O-methyl-a-D-glucopyranoside is a synthetic sugar that has been modified with azide and fluoride. It may be used in the synthesis of saccharides as a monosaccharide or oligosaccharide. This compound can be used to prepare glycosylation derivatives, which are complex carbohydrates that are important for cell recognition and immune system function.Formula:C15H21N3O4Purity:Min. 95%Molecular weight:307.35 g/mol


