CAS 861891-50-1

1-methyl-3-(1-methylindol-3-yl)-4-(pentylamino)pyrrole-2,5-dione

Description:

1-Methyl-3-(1-methylindol-3-yl)-4-(pentylamino)pyrrole-2,5-dione, with the CAS number 861891-50-1, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrrole ring and an indole moiety. This compound features a methyl group and a pentylamino substituent, contributing to its unique chemical properties. It is likely to exhibit significant biological activity due to the presence of the indole and pyrrole functionalities, which are known to participate in various biochemical interactions. The compound may be soluble in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. Additionally, its potential applications could span across fields such as medicinal chemistry and materials science, although specific biological activities and mechanisms would require further investigation. As with many synthetic compounds, safety and handling precautions should be observed, particularly in laboratory settings.

Formula: C₁₉H₂₃N₃O₂

InChI: InChI=1/C19H23N3O2/c1-4-5-8-11-20-17-16(18(23)22(3)19(17)24)14-12-21(2)15-10-7-6-9-13(14)15/h6-7,9-10,12,20H,4-5,8,11H2,1-3H3

SMILES: CCCCCNC1=C(c2cn(C)c3ccccc23)C(=O)N(C)C1=O

Necrosis Inhibitor, IM-54

CAS: 861891-50-1

Formula: C₁₉H₂₃N₃O₂

Purity: 99%

Color and Shape: Solid

Molecular weight: 325.4048

Ref: IN-DA004SW0

IM-54

CAS: 861891-50-1

IM-54

Purity: ≥98%

Molecular weight: 325.4g/mol

Ref: 54-BUP02732

Necrosis Inhibitor, IM-54

CAS: 861891-50-1

IM-54 is a small molecule that inhibits necrotic cell death. It binds to the reactive oxygen species, which are generated during necrosis and disrupt cellular function. Xylitol dehydrogenase is an enzyme that converts xylitol into NADPH and increases autophagy in the cells. Autophagy is a process of self-digestion where damaged or unnecessary proteins are degraded by lysosomes. This process can be inhibited by IM-54, which may make it an anticancer agent because cancer cells depend on autophagy for survival. The basic structure of IM-54 has been found to inhibit polymerase chain reaction (PCR). This inhibition may be due to its ability to bind to the DNA template, thereby inhibiting the activity of DNA polymerase. IM-54 also has inhibitory effects on prostate cancer cells and murine hepatoma cells in culture, as well as Sprague Dawley rats with cancer.

Formula: C₁₉H₂₃N₃O₂

Purity: Min. 95%

Molecular weight: 325.4 g/mol

Ref: 3D-LJB89150

IM-54

CAS: 861891-50-1

IM-54 is a cell-permeable, effective, and selective necrosis inhibitor.

Formula: C₁₉H₂₃N₃O₂

Purity: 99.24%

Color and Shape: Solid

Molecular weight: 325.4

Ref: TM-T24160