CymitQuimica logo

CAS 861905-87-5

:

6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole

Description:
6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, with the CAS number 861905-87-5, is a chemical compound that features a unique combination of an indazole moiety and a dioxaborolane group. The indazole structure contributes to its potential biological activity, often associated with various pharmacological properties. The presence of the dioxaborolane group enhances its reactivity and solubility, making it useful in synthetic applications, particularly in organic synthesis and medicinal chemistry. This compound is characterized by its stability under standard conditions, although it may be sensitive to moisture due to the boron atom. Its molecular structure allows for potential interactions with biological targets, which can be explored in drug development. Additionally, the presence of bulky tetramethyl groups in the dioxaborolane enhances steric hindrance, which can influence the compound's reactivity and selectivity in chemical reactions. Overall, this compound represents a versatile building block in the field of organic chemistry and drug design.
Formula:C13H17BN2O2
InChI:InChI=1/C13H17BN2O2/c1-12(2)13(3,4)18-14(17-12)10-6-5-9-8-15-16-11(9)7-10/h5-8H,1-4H3,(H,15,16)
SMILES:CC1(C)C(C)(C)OB(c2ccc3c[nH]nc3c2)O1
Synonyms:
  • 1H-Indazole-6-boronic acid pinacol ester
  • 1H-Indazole, 6-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-
  • 6-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.