CAS 861928-27-0

4-Bromo-2-(trifluoromethyl)benzaldehyde

Description:

4-Bromo-2-(trifluoromethyl)benzaldehyde is an aromatic aldehyde characterized by the presence of a bromine atom and a trifluoromethyl group attached to a benzene ring. The molecular structure features a benzaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. This compound is typically a pale yellow to light brown solid at room temperature and is known for its distinctive odor associated with aldehydes. It is soluble in organic solvents such as dichloromethane and ethyl acetate but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the trifluoromethyl group enhances its electron-withdrawing properties, which can influence its reactivity in electrophilic aromatic substitution reactions. Additionally, 4-Bromo-2-(trifluoromethyl)benzaldehyde can serve as an important intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals, making it valuable in both research and industrial applications. Proper handling and storage are essential due to its potential toxicity and environmental impact.

Formula: C₈H₄BrF₃O

InChI: InChI=1S/C8H4BrF3O/c9-6-2-1-5(4-13)7(3-6)8(10,11)12/h1-4H

InChI key: InChIKey=PROPHDFGNNBHJX-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(C=O)C=CC(Br)=C1

Synonyms:

• Benzaldehyde, 4-Bromo-2-(Trifluoromethyl)-
• 4-Bromo-2-(trifluoromethyl)benzaldehyde

4-BROMO-2-(TRIFLUOROMETHYL)BENZALDEHYDE

CAS: 861928-27-0

Formula: C₈H₄BrF₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 253.0160

Ref: IN-DA003KVG

4-Bromo-2-(trifluoromethyl)benzaldehyde

CAS: 861928-27-0

4-Bromo-2-(trifluoromethyl)benzaldehyde

Formula: C₈H₄BrF₃O

Purity: 98%

Color and Shape: off-white solid

Molecular weight: 253.02g/mol

Ref: 54-PC49241

4-Bromo-2-(trifluoromethyl)benzaldehyde

CAS: 861928-27-0

Formula: C₈H₄BrF₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 253.018

Ref: 10-F217858