CAS 862129-81-5
:4,4,5,5-Tetramethyl-2-(tetrahydro-2H-thiopyran-4-yl)-1,3,2-dioxaborolane
Description:
4,4,5,5-Tetramethyl-2-(tetrahydro-2H-thiopyran-4-yl)-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a tetrahydrothiopyran moiety. This compound typically exhibits a colorless to pale yellow appearance and is soluble in organic solvents, which is common for many boron compounds. The presence of the dioxaborolane functional group suggests potential applications in organic synthesis, particularly in the formation of boronate esters, which are valuable intermediates in various chemical reactions, including cross-coupling reactions. The tetrahydrothiopyran ring may impart specific reactivity or stability, influencing its behavior in chemical processes. Additionally, the presence of multiple methyl groups contributes to steric hindrance, which can affect the compound's reactivity and interactions with other molecules. Overall, this compound is of interest in synthetic organic chemistry and may have applications in materials science or medicinal chemistry, although specific applications would depend on further research and exploration of its properties.
Formula:C11H21BO2S
InChI:InChI=1/C11H21BO2S/c1-10(2)11(3,4)14-12(13-10)9-5-7-15-8-6-9/h9H,5-8H2,1-4H3
SMILES:CC1(C)C(C)(C)OB(C2CCSCC2)O1
Synonyms:- 3,6-Dihydro-2h-thiopyran-4-ylboronic acid pinacol ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,6-Dihydrothiopyran-4-boronic acid pinacol ester, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C11H19BO2SPurity:98%Molecular weight:226.142-(3,6-Dihydro-2H-thiopyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:Formula:C11H19BO2SPurity:95%Color and Shape:LiquidMolecular weight:226.14342-(3,6-Dihydro-2H-thiopyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:2-(3,6-Dihydro-2H-thiopyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolanePurity:97%Color and Shape:SolidMolecular weight:226.14g/mol2-(3,6-Dihydro-2H-thiopyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:Formula:C11H19BO2SPurity:95%Color and Shape:LiquidMolecular weight:226.14



