CAS 862135-56-6
:5,6-Dibromo-2,3-dihydro-1H-inden-2-ol
Description:
5,6-Dibromo-2,3-dihydro-1H-inden-2-ol is an organic compound characterized by its unique bicyclic structure, which includes a fused indene ring system. The presence of two bromine atoms at the 5 and 6 positions contributes to its reactivity and potential applications in organic synthesis. The hydroxyl group (-OH) at the 2-position enhances its polarity and solubility in polar solvents, making it a valuable intermediate in various chemical reactions. This compound is typically synthesized through bromination and subsequent reduction processes. Its molecular structure allows for potential interactions in biological systems, which may be of interest in medicinal chemistry. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions of synthesis and purification. As with many brominated compounds, it is essential to handle 5,6-Dibromo-2,3-dihydro-1H-inden-2-ol with care due to the potential for toxicity and environmental impact associated with brominated organic substances.
Formula:C9H8Br2O
InChI:InChI=1S/C9H8Br2O/c10-8-3-5-1-7(12)2-6(5)4-9(8)11/h3-4,7,12H,1-2H2
InChI key:InChIKey=BYQBQMKPJNLTPY-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(=CC1Br)CC(O)C2
Synonyms:- 5,6-Dibromo-2,3-dihydro-1H-inden-2-ol
- 1H-Inden-2-ol, 5,6-dibromo-2,3-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
