CymitQuimica logo

CAS 86225-70-9

:

5-(2-bromopropanoyl)-2-methoxy-benzenesulfonamide

Description:
5-(2-Bromopropanoyl)-2-methoxy-benzenesulfonamide, with the CAS number 86225-70-9, is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a methoxy group (-OCH3) attached to a benzene ring, enhancing its solubility and reactivity. The presence of the bromopropanoyl moiety introduces a halogen, which can influence the compound's reactivity and biological activity. Typically, sulfonamides exhibit a range of pharmacological effects, including antimicrobial activity, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting bacterial infections. Additionally, the compound's stability, solubility, and reactivity can be influenced by the electronic effects of the substituents on the benzene ring and the sulfonamide group. Overall, this compound represents a unique combination of functional groups that may contribute to its biological activity and potential therapeutic applications.
Formula:C10H12BrNO4S
InChI:InChI=1/C10H12BrNO4S/c1-6(11)10(13)7-3-4-8(16-2)9(5-7)17(12,14)15/h3-6H,1-2H3,(H2,12,14,15)
SMILES:CC(C(=O)c1ccc(c(c1)S(=O)(=O)N)OC)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.