CAS 86225-78-7

4-(1-aminoethyl)-Benzonitrile

Description:

4-(1-Aminoethyl)-benzonitrile, with the CAS number 86225-78-7, is an organic compound characterized by the presence of a benzonitrile moiety substituted with an aminoethyl group at the para position. This compound typically appears as a solid or crystalline substance and is known for its potential applications in pharmaceuticals and organic synthesis. The aminoethyl group contributes to its basicity and reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The presence of the nitrile functional group (–C≡N) imparts unique properties, including polarity and the ability to engage in hydrogen bonding, which can influence solubility and reactivity. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-(1-aminoethyl)-benzonitrile is a versatile compound with significant relevance in chemical research and development.

Formula: C₉H₁₀N₂

InChI: InChI=1S/C9H10N2/c1-7(11)9-4-2-8(6-10)3-5-9/h2-5,7H,11H2,1H3

SMILES: CC(c1ccc(cc1)C#N)N

Synonyms:

• Benzonitrile, 4-(1-aminoethyl)-
• 4-(1-aminoethyl)benzonitrile
• 4-(1-AMinoethyl)-benzonitrile HCl
• 4-(1-Aminomethyl)benzonitrile

Benzonitrile, 4-(1-aminoethyl)-

CAS: 86225-78-7

Formula: C₉H₁₀N₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 146.1891

Ref: IN-DA00IDYQ

4-(1-Aminoethyl)benzonitrile

CAS: 86225-78-7

4-(1-Aminoethyl)benzonitrile

Purity: 98%

Molecular weight: 146.19g/mol

Ref: 54-OR1059635

4-(1-Aminoethyl)benzonitrile

CAS: 86225-78-7

4-(1-Aminoethyl)benzonitrile (AEB) is a compound that is used to treat cardiac hypertrophy. It is an innovative drug that inhibits the growth of cardiomyocytes by inhibiting collagen synthesis and inducing their apoptosis. AEB inhibits the production of collagen, which is needed for the development of cardiac hypertrophy. AEB also modulates the expression of proteins involved in muscle function, including protein genes and lipase.

Formula: C₉H₁₀N₂

Purity: Min. 95%

Molecular weight: 146.19 g/mol

Ref: 3D-LDA22578