
CAS 86227-80-7
:2,2,3,4,4,4-Hexafluorobutyl acrylate homopolymer
Description:
2,2,3,4,4,4-Hexafluorobutyl acrylate homopolymer, identified by CAS number 86227-80-7, is a fluorinated polymer known for its unique properties derived from the presence of fluorine atoms. This polymer exhibits excellent chemical resistance, thermal stability, and low surface energy, making it suitable for applications in coatings, adhesives, and sealants. The fluorinated structure imparts hydrophobic characteristics, enhancing its performance in environments where moisture resistance is critical. Additionally, the polymer demonstrates good mechanical strength and flexibility, which can be advantageous in various industrial applications. Its low refractive index and high transparency make it appealing for optical applications as well. The synthesis of this homopolymer typically involves free radical polymerization of the acrylate monomer, resulting in a material that can be tailored for specific performance requirements. Overall, 2,2,3,4,4,4-Hexafluorobutyl acrylate homopolymer is valued for its distinctive properties that combine functionality with durability in demanding applications.
Formula:(C7H6F6O2)x
InChI:InChI=1S/C7H6F6O2/c1-2-4(14)15-3-6(9,10)5(8)7(11,12)13/h2,5H,1,3H2
InChI key:InChIKey=LMVLEDTVXAGBJV-UHFFFAOYSA-N
SMILES:C(C(C(F)(F)F)F)(COC(C=C)=O)(F)F
Synonyms:- Poly(1H,1H,3H-hexafluorobutyl acrylate)
- 2,2,3,4,4,4-Hexafluorobutyl acrylate homopolymer
- 2-Propenoic acid, 2,2,3,4,4,4-hexafluorobutyl ester, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
