CymitQuimica logo

CAS 862274-40-6

:

2,3-Dihydro-3-oxo-1H-indazole-6-carboxylic acid

Description:
2,3-Dihydro-3-oxo-1H-indazole-6-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of a keto group at the 3-position enhances its reactivity and potential for forming various derivatives. It is typically a white to off-white solid and is soluble in polar solvents, which is common for compounds with carboxylic acid groups. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure allows for potential interactions with biological targets, and it may serve as a scaffold for the synthesis of more complex molecules. As with many organic compounds, proper handling and storage are essential to maintain its stability and integrity.
Formula:C8H6N2O3
InChI:InChI=1S/C8H6N2O3/c11-7-5-2-1-4(8(12)13)3-6(5)9-10-7/h1-3H,(H,12,13)(H2,9,10,11)
InChI key:InChIKey=QASUNHBHNOVFQK-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(C(O)=O)=CC2)NN1
Synonyms:
  • 3-Hydroxy-1H-indazole-6-carboxylic acid
  • 3-Hydroxy-2H-indazole-6-carboxylic acid
  • 1H-Indazole-6-carboxylic acid, 2,3-dihydro-3-oxo-
  • 2,3-Dihydro-3-oxo-1H-indazole-6-carboxylic acid
  • 3-Oxo-2,3-dihydro-1H-indazole-6-carboxylic acid
Found 1 products.