CAS 86236-77-3
:1,3-Dibenzyl-5-cyanohexahydropyrimidine
Description:
1,3-Dibenzyl-5-cyanohexahydropyrimidine is a chemical compound characterized by its unique structure, which includes a hexahydropyrimidine ring substituted with two benzyl groups and a cyano group. This compound typically exhibits properties associated with heterocyclic compounds, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the cyano group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions. The dibenzyl substituents may enhance its lipophilicity, influencing its biological activity and interaction with other molecules. Additionally, this compound may be of interest in medicinal chemistry due to its structural features, which could lead to the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety data should be consulted to understand its handling and toxicity. Overall, 1,3-Dibenzyl-5-cyanohexahydropyrimidine represents a versatile structure with potential applications in various fields of chemistry.
Formula:C19H21N3
InChI:InChI=1/C19H21N3/c20-11-19-14-21(12-17-7-3-1-4-8-17)16-22(15-19)13-18-9-5-2-6-10-18/h1-10,19H,12-16H2
SMILES:c1ccc(cc1)CN1CC(C#N)CN(Cc2ccccc2)C1
Synonyms:- 1,3-Dibenzylhexahydropyrimidine-5-Carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
