CAS 86236-84-2
:Morpholin-3-yl-acetic acid
Description:
Morpholin-3-yl-acetic acid, identified by its CAS number 86236-84-2, is an organic compound characterized by the presence of a morpholine ring and an acetic acid functional group. This compound typically exhibits properties associated with both amines and carboxylic acids, making it a versatile molecule in various chemical applications. Morpholin-3-yl-acetic acid is generally soluble in polar solvents due to its ability to form hydrogen bonds, which enhances its reactivity and interaction with biological systems. The morpholine moiety contributes to its potential as a building block in medicinal chemistry, particularly in the development of pharmaceuticals, as it can influence the compound's biological activity and pharmacokinetics. Additionally, the presence of the acetic acid group may impart acidic characteristics, allowing for potential applications in buffer solutions or as a reagent in organic synthesis. Overall, morpholin-3-yl-acetic acid is a compound of interest in both research and industrial contexts due to its unique structural features and functional properties.
Formula:C6H11NO3
InChI:InChI=1/C6H11NO3/c8-6(9)3-5-4-10-2-1-7-5/h5,7H,1-4H2,(H,8,9)
SMILES:C1COCC(CC(=O)O)N1
Synonyms:- 3-Morpholineacetic Acid
- Morpholin-3-ylacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
