CymitQuimica logo

CAS 862372-86-9

:

(R)-1-Boc-3-Aminopiperidine-3-carboxylic acid

Description:
(R)-1-Boc-3-Aminopiperidine-3-carboxylic acid is a chiral compound characterized by its piperidine ring structure, which includes a tert-butoxycarbonyl (Boc) protecting group and a carboxylic acid functional group. The presence of the amino group at the 3-position of the piperidine ring contributes to its basicity and potential reactivity in various chemical reactions, particularly in peptide synthesis and medicinal chemistry. The Boc group serves as a protective moiety, allowing for selective reactions at other functional sites while stabilizing the amine. This compound is typically used in the synthesis of pharmaceuticals and biologically active molecules due to its ability to serve as a building block in the formation of more complex structures. Its chirality is significant in drug development, as the (R)-enantiomer may exhibit different biological activity compared to its (S)-counterpart. Overall, (R)-1-Boc-3-Aminopiperidine-3-carboxylic acid is valued for its versatility in organic synthesis and its role in the development of therapeutic agents.
Formula:C11H20N2O4
InChI:InChI=1/C11H20N2O4/c1-10(2,3)17-9(16)13-6-4-5-11(12,7-13)8(14)15/h4-7,12H2,1-3H3,(H,14,15)/t11-/m1/s1
SMILES:CC(C)(C)OC(=O)N1CCC[C@@](C1)(C(=O)O)N
Synonyms:
  • (R)-3-Amino-1-(tert-butoxycarbonyl)piperidine-3-carboxylic acid
  • (R)-3-Amino-piperidine-1,3-dicarboxylic acid 1-tert-butyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.