CymitQuimica logo

CAS 86241-63-6

:

2-Chloro-N-[2-(2-oxo-1-imidazolidinyl)ethyl]acetamide

Description:
2-Chloro-N-[2-(2-oxo-1-imidazolidinyl)ethyl]acetamide, with the CAS number 86241-63-6, is a chemical compound that features a chloroacetamide structure. This compound is characterized by the presence of a chloro group, an acetamide functional group, and an imidazolidinone moiety, which contributes to its potential biological activity. The imidazolidinyl portion suggests that it may exhibit properties relevant to medicinal chemistry, possibly acting as a bioactive agent. The compound is typically a solid at room temperature and may be soluble in polar organic solvents. Its molecular structure indicates potential interactions with biological targets, making it of interest in pharmaceutical research. Additionally, the presence of the chloro substituent may influence its reactivity and stability. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, 2-Chloro-N-[2-(2-oxo-1-imidazolidinyl)ethyl]acetamide represents a unique compound with potential applications in various fields, particularly in drug development.
Formula:C7H12ClN3O2
InChI:InChI=1S/C7H12ClN3O2/c8-5-6(12)9-1-3-11-4-2-10-7(11)13/h1-5H2,(H,9,12)(H,10,13)
InChI key:InChIKey=WWPDRTXZZHBFQT-UHFFFAOYSA-N
SMILES:C(CNC(CCl)=O)N1C(=O)NCC1
Synonyms:
  • Acetamide, 2-chloro-N-[2-(2-oxo-1-imidazolidinyl)ethyl]-
  • 2-Chloro-N-[2-(2-oxo-1-imidazolidinyl)ethyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.