CymitQuimica logo

CAS 86241-68-1

:

2,2-Dimethyl-3-oxo-1-piperazinecarbonitrile

Description:
2,2-Dimethyl-3-oxo-1-piperazinecarbonitrile is a chemical compound characterized by its piperazine ring structure, which is a six-membered ring containing two nitrogen atoms. This compound features a carbonitrile functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the dimethyl groups enhances its steric properties and may influence its solubility and interaction with biological systems. Typically, compounds like this are of interest in medicinal chemistry due to their potential pharmacological activities. The oxo group indicates the presence of a carbonyl, which can participate in various chemical reactions, including nucleophilic additions. The CAS number 86241-68-1 uniquely identifies this substance in chemical databases, facilitating research and regulatory processes. Overall, 2,2-Dimethyl-3-oxo-1-piperazinecarbonitrile is a versatile compound with potential applications in drug development and synthetic chemistry, although specific biological activities and properties would require further investigation through empirical studies.
Formula:C7H11N3O
InChI:InChI=1S/C7H11N3O/c1-7(2)6(11)9-3-4-10(7)5-8/h3-4H2,1-2H3,(H,9,11)
InChI key:InChIKey=NLOKXMIYIMHKBC-UHFFFAOYSA-N
SMILES:C(#N)N1C(C)(C)C(=O)NCC1
Synonyms:
  • 1-Piperazinecarbonitrile, 2,2-dimethyl-3-oxo-
  • 2,2-Dimethyl-3-oxo-1-piperazinecarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.