CymitQuimica logo

CAS 86244-33-9

:

5-(2-amino-1-chloro-propyl)-2-methoxy-benzenesulfonamide hydrochloride

Description:
5-(2-amino-1-chloro-propyl)-2-methoxy-benzenesulfonamide hydrochloride, with the CAS number 86244-33-9, is a chemical compound characterized by its sulfonamide structure, which includes a sulfonyl group attached to an aromatic ring. This compound features a methoxy group and an amino group, contributing to its potential biological activity. The presence of the chlorine atom on the propyl chain may influence its reactivity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. The compound may exhibit properties such as antibacterial or anti-inflammatory effects, common to many sulfonamides, although specific biological activities would depend on further empirical studies. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Proper handling and storage conditions are essential due to its chemical nature, and safety data sheets should be consulted for information on toxicity and safety precautions.
Formula:C10H16Cl2N2O3S
InChI:InChI=1/C10H15ClN2O3S.ClH/c1-6(12)10(11)7-3-4-8(16-2)9(5-7)17(13,14)15;/h3-6,10H,12H2,1-2H3,(H2,13,14,15);1H
SMILES:CC(C(c1ccc(c(c1)S(=O)(=O)N)OC)Cl)N.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.