CAS 862483-52-1

cycloheptylthiourea

Description:

Cycloheptylthiourea is an organic compound characterized by its cyclic structure and the presence of a thiourea functional group. It features a cycloheptyl ring, which consists of seven carbon atoms arranged in a cyclic formation, contributing to its unique chemical properties. The thiourea moiety, characterized by the presence of a carbonyl group bonded to a sulfur atom and two amine groups, imparts significant reactivity, particularly in forming coordination complexes and participating in nucleophilic reactions. Cycloheptylthiourea is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its applications can range from use in organic synthesis to potential roles in biological systems, where it may interact with various biological targets. The compound's properties, such as melting point, boiling point, and reactivity, can vary based on its purity and the specific conditions under which it is handled. As with many thiourea derivatives, it is essential to consider safety and handling precautions due to potential toxicity and reactivity.

Formula: C₈H₁₆N₂S

InChI: InChI=1/C8H16N2S/c9-8(11)10-7-5-3-1-2-4-6-7/h7H,1-6H2,(H3,9,10,11)

SMILES: C1CCCC(CC1)NC(=N)S

Synonyms:

• 1-Cycloheptylthioharnstoff
• 1-Cycloheptylthiourea
• thiourea, N-cycloheptyl-

Cycloheptylthiourea

CAS: 862483-52-1

Cycloheptylthiourea is a chemical compound that has been found to inhibit the growth of ovarian cancer cells in vitro. Cycloheptylthiourea inhibits the growth of cancer cells by inducing apoptosis in these cells. It also inhibits the production of androgen hormones, which are known to be associated with polycystic ovarian syndrome. Dehydrogenase activity was not shown in this study, which may account for its low activity as an anti-cancer drug. The chemical formula for cycloheptylthiourea is C11H12N2O2S.

Formula: C₈H₁₆N₂S

Purity: Min. 95%

Molecular weight: 172.29 g/mol

Ref: 3D-MJB48352