CAS 862501-92-6

1,1-Dimethylethyl 4-aminobicyclo[2.2.2]octane-1-carboxylate

Description:

1,1-Dimethylethyl 4-aminobicyclo[2.2.2]octane-1-carboxylate, identified by its CAS number 862501-92-6, is a chemical compound that features a bicyclic structure, specifically a bicyclo[2.2.2]octane framework. This compound is characterized by the presence of a carboxylate functional group and an amino group, which contribute to its reactivity and potential biological activity. The dimethyl group attached to the carbon atom enhances steric hindrance, influencing the compound's interactions with biological targets. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of both polar and nonpolar functional groups suggests that it may engage in various intermolecular interactions, making it of interest in medicinal chemistry and drug design. Its unique structure may also confer specific pharmacological properties, although detailed studies would be necessary to elucidate its biological effects and potential applications. Safety data and handling precautions should be considered when working with this compound, as with any chemical substance.

Formula: C₁₃H₂₃NO₂

InChI: InChI=1S/C13H23NO2/c1-11(2,3)16-10(15)12-4-7-13(14,8-5-12)9-6-12/h4-9,14H2,1-3H3

InChI key: InChIKey=PCFGKTJBVISTMN-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)C12CCC(N)(CC1)CC2

Synonyms:

• Bicyclo[2.2.2]octane-1-carboxylic acid, 4-amino-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-aminobicyclo[2.2.2]octane-1-carboxylate

tert-butyl 4-aminobicyclo[2.2.2]octane-1-carboxylate

CAS: 862501-92-6

Formula: C₁₃H₂₃NO₂

Purity: 97%

Molecular weight: 225.3272

Ref: IN-DA01EE2G

tert-Butyl 4-aminobicyclo[2.2.2]octane-1-carboxylate

CAS: 862501-92-6

Versatile small molecule scaffold

Formula: C₁₃H₂₃NO₂

Purity: Min. 95%

Molecular weight: 225.33 g/mol

Ref: 3D-MJB50192