CymitQuimica logo

CAS 862508-03-0

:

Pentyl (5-fluoro-2-oxo-1,2-dihydro-4-pyrimidinyl)carbamate

Description:
Pentyl (5-fluoro-2-oxo-1,2-dihydro-4-pyrimidinyl)carbamate, with the CAS number 862508-03-0, is a chemical compound that belongs to the class of pyrimidine derivatives. It features a pyrimidine ring substituted with a fluorine atom and a carbamate functional group, which contributes to its potential biological activity. The presence of the pentyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its structure suggests that it could interact with biological targets, possibly serving as a lead compound for further optimization. The fluorine substitution can enhance metabolic stability and alter the compound's interaction with biological systems. As with many pyrimidine derivatives, it may be investigated for applications in areas such as antiviral or anticancer therapies. However, specific biological activities and safety profiles would require further empirical studies to establish its efficacy and potential therapeutic uses.
Formula:C10H14FN3O3
InChI:InChI=1S/C10H14FN3O3/c1-2-3-4-5-17-10(16)14-8-7(11)6-12-9(15)13-8/h6H,2-5H2,1H3,(H2,12,13,14,15,16)
SMILES:CCCCCOC(=Nc1c(cnc(n1)O)F)O
Synonyms:
  • Pentyl (5-Fluoro-2-Oxo-1,2-Dihydropyrimidin-4-Yl)Carbamate
  • (5-Fluoro-1,2-dihydro-2-oxo-4-pyrimidinyl)carbamic acid pentyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.