CAS 86252-65-5
:(2Z,13Z)-octadeca-2,13-dien-1-yl acetate
Description:
(2Z,13Z)-octadeca-2,13-dien-1-yl acetate, with the CAS number 86252-65-5, is an organic compound characterized by its long carbon chain structure, featuring a total of 18 carbon atoms. This compound is an unsaturated fatty acid derivative, specifically an ester formed from the reaction of an alcohol and an acid. The presence of two double bonds in the carbon chain, located at the 2nd and 13th positions, contributes to its reactivity and potential applications in various fields, including biochemistry and materials science. The acetate functional group indicates that it is an ester, which typically imparts certain properties such as volatility and solubility in organic solvents. This compound may exhibit biological activity, making it of interest in studies related to lipid metabolism or as a potential flavoring or fragrance agent. Its structural configuration, denoted by the Z (cis) notation, suggests specific spatial arrangements that can influence its physical and chemical properties, including melting point, boiling point, and reactivity with other substances.
Formula:C20H36O2
InChI:InChI=1/C20H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20(2)21/h6-7,17-18H,3-5,8-16,19H2,1-2H3/b7-6-,18-17-
SMILES:CCCC/C=C\CCCCCCCCC/C=C\COC(=O)C
Synonyms:- 2,13-Octadecadien-1-ol, acetate, (2Z,13Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(2Z,13Z)-Octadecadienyl Acetate
CAS:Controlled ProductFormula:C20H36O2Color and Shape:NeatMolecular weight:308.499
