CAS 86256-59-9
:2-Methyl-4-(trifluoromethoxy)aniline
Description:
2-Methyl-4-(trifluoromethoxy)aniline is an organic compound characterized by its aniline structure, which features an amino group (-NH2) attached to a benzene ring. The presence of a methyl group at the second position and a trifluoromethoxy group (-O-CF3) at the fourth position of the aromatic ring significantly influences its chemical properties. This compound is typically a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to the trifluoromethoxy group, which can enhance lipophilicity and metabolic stability. The trifluoromethoxy group also contributes to the compound's unique reactivity and interaction with biological systems. Additionally, 2-Methyl-4-(trifluoromethoxy)aniline may exhibit specific solubility characteristics, making it suitable for various synthetic processes. Safety data should be consulted for handling, as compounds containing fluorinated groups can pose environmental and health risks. Overall, this compound represents a valuable structure in the field of medicinal chemistry and materials science.
Formula:C8H8F3NO
InChI:InChI=1/C8H8F3NO/c1-5-4-6(2-3-7(5)12)13-8(9,10)11/h2-4H,12H2,1H3
SMILES:Cc1cc(ccc1N)OC(F)(F)F
Synonyms:- Benzenamine, 2-Methyl-4-(Trifluoromethoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Methyl-4-(trifluoromethoxy)aniline, 97+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H8F3NOPurity:97+%Color and Shape:Clear pale yellow to pale orange, LiquidMolecular weight:191.152-methyl-4-(trifluoromethoxy)aniline
CAS:Formula:C8H8F3NOPurity:97%Color and Shape:LiquidMolecular weight:191.15042-Methyl-4-(trifluoromethoxy)aniline
CAS:2-Methyl-4-(trifluoromethoxy)anilineFormula:C8H8F3NOPurity:97%Color and Shape: colourless liquidMolecular weight:191.15g/mol2-METHYL-4-TRIFLUOROMETHOXYANILINE
CAS:Formula:C8H8F3NOPurity:97%Color and Shape:LiquidMolecular weight:191.153




