CAS 86256-88-4
:3-bromo-5-phenyl-4,5-dihydro-1,2-oxazole
Description:
3-Bromo-5-phenyl-4,5-dihydro-1,2-oxazole is a heterocyclic organic compound characterized by the presence of a bromine atom and a phenyl group attached to a dihydro-oxazole ring. The oxazole ring consists of a five-membered structure containing both nitrogen and oxygen atoms, contributing to its unique chemical properties. This compound typically exhibits moderate stability under standard conditions, but its reactivity can be influenced by the presence of the bromine substituent, which can participate in nucleophilic substitution reactions. The phenyl group enhances the compound's lipophilicity, potentially affecting its solubility in organic solvents. Additionally, the presence of the dihydro configuration suggests that the compound may exist in a specific stereochemical form, which can influence its biological activity and interactions. Overall, 3-bromo-5-phenyl-4,5-dihydro-1,2-oxazole is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex molecules.
Formula:C9H8BrNO
InChI:InChI=1/C9H8BrNO/c10-9-6-8(12-11-9)7-4-2-1-3-5-7/h1-5,8H,6H2
SMILES:c1ccc(cc1)C1CC(=NO1)Br
Synonyms:- Isoxazole, 3-bromo-4,5-dihydro-5-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
