CAS 86259-87-2
:1-phenyl-2,5,8,11-tetraoxatridecan-13-ol
Description:
1-Phenyl-2,5,8,11-tetraoxatridecan-13-ol, with the CAS number 86259-87-2, is a synthetic organic compound characterized by its long carbon chain and multiple ether linkages. This molecule features a phenyl group, which contributes to its aromatic properties, and a hydroxyl group (-OH) that imparts alcohol characteristics, influencing its solubility and reactivity. The presence of four ether linkages (–O–) within the tridecane backbone enhances its stability and can affect its physical properties, such as melting and boiling points. The compound is likely to exhibit moderate polarity due to the hydroxyl group, making it soluble in polar solvents while retaining some hydrophobic characteristics from the long carbon chain. Its unique structure may allow for various applications in fields such as materials science, pharmaceuticals, or as a surfactant, depending on its specific properties and interactions with other substances. However, detailed studies on its biological activity, toxicity, and environmental impact would be necessary to fully understand its potential uses and safety profile.
Formula:C15H24O5
InChI:InChI=1/C15H24O5/c16-6-7-17-8-9-18-10-11-19-12-13-20-14-15-4-2-1-3-5-15/h1-5,16H,6-14H2
SMILES:c1ccc(cc1)COCCOCCOCCOCCO
Synonyms:- 2,5,8,11-tetraoxatridecan-13-ol, 1-phenyl-Tetraethylene glycol monobenzyl ether
- Tetraethylene glycol monobenzyl ether
- Bn-PEG4-OH
- 1-Phenyl-2,5,8,11-tetraoxatridecan-13-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Tetraethylene Glycol Monobenzyl Ether
CAS:Formula:C15H24O5Purity:>95.0%(GC)Color and Shape:White to Yellow to Green clear liquidMolecular weight:284.351-phenyl-2,5,8,11-tetraoxatridecan-13-ol
CAS:Formula:C15H24O5Purity:96%Color and Shape:LiquidMolecular weight:284.3481BnO-PEG4-OH
CAS:BnO-PEG4-OH is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.Formula:C15H24O5Color and Shape:SolidMolecular weight:284.351-Phenyl-2,5,8,11-tetraoxatridecan-13-ol
CAS:Formula:C15H24O5Purity:96%Color and Shape:LiquidMolecular weight:284.352Tetraethylene glycol monobenzyl ether
CAS:Tetraethylene glycol monobenzyl ether is a PEG polymer categorised as monofunctional (OH-PEG-X). Used as a linker, tetraethylene glycol monobenzyl ether is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.Formula:C15H24O5Purity:Min. 95%Color and Shape:Light (Or Pale) Yellow To Yellow LiquidMolecular weight:284.35 g/mol





