CymitQuimica logo

CAS 862595-54-8

:

2-Methoxy-6-(1H-pyrrol-1-yl)benzonitrile

Description:
2-Methoxy-6-(1H-pyrrol-1-yl)benzonitrile, with the CAS number 862595-54-8, is an organic compound characterized by its complex structure, which includes a methoxy group, a pyrrole moiety, and a benzonitrile functional group. This compound typically exhibits a moderate to high polarity due to the presence of the nitrile and methoxy groups, which can influence its solubility in various solvents. It may display interesting biological activities, making it of interest in medicinal chemistry and drug development. The presence of the pyrrole ring can contribute to its reactivity and potential interactions with biological targets. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 2-Methoxy-6-(1H-pyrrol-1-yl)benzonitrile is a compound of interest for further research, particularly in the fields of organic synthesis and pharmacology.
Formula:C12H10N2O
InChI:InChI=1S/C12H10N2O/c1-15-12-6-4-5-11(10(12)9-13)14-7-2-3-8-14/h2-8H,1H3
InChI key:InChIKey=BMCUJYHPLBUIBZ-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=CC=C1OC)N2C=CC=C2
Synonyms:
  • Benzonitrile, 2-methoxy-6-(1H-pyrrol-1-yl)-
  • 2-Methoxy-6-(1H-pyrrol-1-yl)benzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.