CAS 862599-47-1

ethyl 2-chlorooxazole-5-carboxylate

Description:

Ethyl 2-chlorooxazole-5-carboxylate is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of a chloro substituent at the 2-position and an ethyl ester group at the carboxylate position contributes to its reactivity and potential applications in organic synthesis. This compound typically exhibits moderate polarity due to the presence of the carboxylate group, which can participate in hydrogen bonding. Its molecular structure allows for various chemical transformations, making it useful in the synthesis of more complex molecules, particularly in medicinal chemistry and agrochemical development. Ethyl 2-chlorooxazole-5-carboxylate may also display biological activity, although specific biological properties would require further investigation. As with many chemical substances, handling should be done with care, adhering to safety guidelines to mitigate any potential hazards associated with its use.

Formula: C₆H₆ClNO₃

InChI: InChI=1/C6H6ClNO3/c1-2-10-5(9)4-3-8-6(7)11-4/h3H,2H2,1H3

SMILES: CCOC(=O)c1cnc(Cl)o1

Synonyms:

• Ethyl 2-chloro-1,3-oxazole-5-carboxylate

Ethyl 2-chlorooxazole-5-carboxylate

CAS: 862599-47-1

Formula: C₆H₆ClNO₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 175.5697

Ref: IN-DA004JHA

Ethyl 2-chloro-1,3-oxazole-5-carboxylate

CAS: 862599-47-1

Ethyl 2-chloro-1,3-oxazole-5-carboxylate

Formula: C₆H₆ClNO₃

Purity: 98%

Color and Shape: orange liquid

Molecular weight: 175.57g/mol

Ref: 54-OR11484

Ethyl 2-chlorooxazole-5-carboxylate

CAS: 862599-47-1

Formula: C₆H₆ClNO₃

Purity: 95%

Color and Shape: Liquid

Molecular weight: 175.57

Ref: 10-F050482