CAS 86263-61-8

1-ethyl-1H-imidazole-4,5-dicarboxylic acid

Description:

1-Ethyl-1H-imidazole-4,5-dicarboxylic acid is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features two carboxylic acid functional groups at the 4 and 5 positions of the imidazole ring, contributing to its acidic properties. The ethyl group at the 1-position enhances its solubility in polar solvents and may influence its reactivity and interaction with biological systems. The presence of multiple functional groups allows for potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Its molecular structure suggests it may participate in various chemical reactions, including esterification and amidation. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. Overall, 1-ethyl-1H-imidazole-4,5-dicarboxylic acid is a versatile compound with potential utility in diverse chemical applications.

Formula: C₇H₈N₂O₄

InChI: InChI=1/C7H8N2O4/c1-2-9-3-8-4(6(10)11)5(9)7(12)13/h3H,2H2,1H3,(H,10,11)(H,12,13)

Synonyms:

• 1H-imidazole-4,5-dicarboxylic acid, 1-ethyl-