CAS 86264-82-6

Methyl 2-(4-chlorophenyl)-4-thiazolidinecarboxylate

Description:

Methyl 2-(4-chlorophenyl)-4-thiazolidinecarboxylate is a chemical compound characterized by its thiazolidine ring structure, which incorporates a carboxylate group and a chlorophenyl substituent. This compound typically exhibits properties associated with thiazolidine derivatives, such as potential biological activity and reactivity due to the presence of the thiazolidine moiety. The 4-chlorophenyl group contributes to its lipophilicity and may influence its interaction with biological targets. Methyl esters, like this compound, are often used in organic synthesis and medicinal chemistry due to their ability to undergo hydrolysis and other transformations. The presence of the chlorine atom can enhance the compound's pharmacological properties, potentially affecting its solubility and binding affinity in biological systems. Overall, this compound may be of interest in research related to pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further studies and evaluations of its biological activity and chemical reactivity.

Formula: C₁₁H₁₂ClNO₂S

InChI: InChI=1S/C11H12ClNO2S/c1-15-11(14)9-6-16-10(13-9)7-2-4-8(12)5-3-7/h2-5,9-10,13H,6H2,1H3

InChI key: InChIKey=CCVTYMKZPBFGAT-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1NC(SC1)C2=CC=C(Cl)C=C2

Synonyms:

• 4-Thiazolidinecarboxylic acid, 2-(4-chlorophenyl)-, methyl ester
• Methyl 2-(4-chlorophenyl)-4-thiazolidinecarboxylate