CAS 862647-93-6

7-Chloro-3,8-dimethyl-2-phenyl-4-quinolinecarboxylic acid

Description:

7-Chloro-3,8-dimethyl-2-phenyl-4-quinolinecarboxylic acid, identified by its CAS number 862647-93-6, is a synthetic organic compound belonging to the quinoline family. This compound features a quinoline core structure, which is characterized by a bicyclic aromatic system containing a nitrogen atom. The presence of the chloro group at the 7-position and methyl groups at the 3 and 8 positions contribute to its unique chemical properties, including potential biological activity. The phenyl group at the 2-position enhances its lipophilicity, which may influence its interaction with biological membranes and receptors. As a carboxylic acid, it possesses acidic properties, allowing it to participate in various chemical reactions, such as esterification or amidation. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which it is studied.

Formula: C₁₈H₁₄ClNO₂

InChI: InChI=1S/C18H14ClNO2/c1-10-14(19)9-8-13-15(18(21)22)11(2)16(20-17(10)13)12-6-4-3-5-7-12/h3-9H,1-2H3,(H,21,22)

InChI key: InChIKey=ASDAJYBCQKUNCE-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C1C)C3=CC=CC=C3)C(C)=C(Cl)C=C2

Synonyms:

• 7-Chloro-3,8-dimethyl-2-phenyl-4-quinolinecarboxylic acid
• 4-Quinolinecarboxylic acid, 7-chloro-3,8-dimethyl-2-phenyl-