CymitQuimica logo

CAS 862647-94-7

:

8-Chloro-2-(2,5-dimethylphenyl)-4-quinolinecarboxylic acid

Description:
8-Chloro-2-(2,5-dimethylphenyl)-4-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features a chloro substituent at the 8-position and a 2,5-dimethylphenyl group at the 2-position, contributing to its unique properties. The carboxylic acid functional group at the 4-position enhances its acidity and potential for hydrogen bonding, making it useful in various chemical reactions and applications. The presence of the chloro group may also influence its reactivity and biological activity. This compound is of interest in medicinal chemistry and may exhibit pharmacological properties, although specific biological activities would depend on further studies. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.
Formula:C18H14ClNO2
InChI:InChI=1S/C18H14ClNO2/c1-10-6-7-11(2)13(8-10)16-9-14(18(21)22)12-4-3-5-15(19)17(12)20-16/h3-9H,1-2H3,(H,21,22)
InChI key:InChIKey=BVLBESAQAQTUNB-UHFFFAOYSA-N
SMILES:CC1=C(C2=NC3=C(C(C(O)=O)=C2)C=CC=C3Cl)C=C(C)C=C1
Synonyms:
  • 4-Quinolinecarboxylic acid, 8-chloro-2-(2,5-dimethylphenyl)-
  • 8-Chloro-2-(2,5-dimethylphenyl)-4-quinolinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.