CymitQuimica logo

CAS 862649-87-4

:

8-Chloro-2-(4-methoxyphenyl)-4-quinolinecarboxylic acid

Description:
8-Chloro-2-(4-methoxyphenyl)-4-quinolinecarboxylic acid is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro substituent at the 8-position and a methoxyphenyl group at the 2-position, contributing to its unique chemical properties. The carboxylic acid functional group at the 4-position enhances its acidity and potential for forming salts or esters. This compound is typically used in medicinal chemistry and research, particularly in the development of pharmaceuticals due to its potential biological activity. Its molecular structure allows for various interactions, making it a candidate for studies related to enzyme inhibition or receptor binding. The presence of the chloro and methoxy groups can influence its solubility, stability, and reactivity, which are critical factors in drug design. As with many quinoline derivatives, it may exhibit antimicrobial or anticancer properties, warranting further investigation in biological assays.
Formula:C17H12ClNO3
InChI:InChI=1S/C17H12ClNO3/c1-22-11-7-5-10(6-8-11)15-9-13(17(20)21)12-3-2-4-14(18)16(12)19-15/h2-9H,1H3,(H,20,21)
InChI key:InChIKey=OOAGKEQGSBZWNV-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C(C1)C3=CC=C(OC)C=C3)C(Cl)=CC=C2
Synonyms:
  • 8-Chloro-2-(4-methoxyphenyl)-4-quinolinecarboxylic acid
  • 4-Quinolinecarboxylic acid, 8-chloro-2-(4-methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.