CAS 862661-16-3

7-Chloro-2-(3,4-dimethylphenyl)-8-methyl-4-quinolinecarboxylic acid

Description:

7-Chloro-2-(3,4-dimethylphenyl)-8-methyl-4-quinolinecarboxylic acid is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro substituent at the 7-position and a carboxylic acid functional group at the 4-position, contributing to its acidic properties. The presence of a 3,4-dimethylphenyl group at the 2-position enhances its hydrophobic characteristics, potentially influencing its solubility and biological activity. The methyl group at the 8-position further modifies its electronic properties. This compound may exhibit interesting pharmacological activities, making it a subject of interest in medicinal chemistry. Its unique structure suggests potential applications in drug development, particularly in targeting specific biological pathways. As with many quinoline derivatives, it may also possess antimicrobial or anti-inflammatory properties, although specific biological activities would require empirical investigation. Proper handling and safety measures should be observed due to the presence of chlorine and the potential for biological activity.

Formula: C₁₉H₁₆ClNO₂

InChI: InChI=1S/C19H16ClNO2/c1-10-4-5-13(8-11(10)2)17-9-15(19(22)23)14-6-7-16(20)12(3)18(14)21-17/h4-9H,1-3H3,(H,22,23)

InChI key: InChIKey=PQJXCQMMSKMAMH-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C1)C3=CC(C)=C(C)C=C3)C(C)=C(Cl)C=C2

Synonyms:

• 7-Chloro-2-(3,4-dimethylphenyl)-8-methyl-4-quinolinecarboxylic acid
• 4-Quinolinecarboxylic acid, 7-chloro-2-(3,4-dimethylphenyl)-8-methyl-