CAS 862686-09-7

4-(4-acetylpiperazin-1-yl)-2-methylaniline

Description:

4-(4-acetylpiperazin-1-yl)-2-methylaniline, with the CAS number 862686-09-7, is an organic compound characterized by its piperazine and aniline functional groups. This compound features a piperazine ring substituted with an acetyl group, which contributes to its potential biological activity. The presence of the methylaniline moiety indicates that it has an aromatic amine structure, which can influence its reactivity and solubility. Typically, compounds like this may exhibit properties such as moderate to high solubility in polar solvents due to the presence of nitrogen atoms, which can engage in hydrogen bonding. Additionally, the acetyl group can enhance lipophilicity, potentially affecting the compound's pharmacokinetics if it is studied for medicinal applications. The compound's structure suggests it may have applications in pharmaceuticals, particularly in the development of drugs targeting central nervous system disorders, given the piperazine's known activity in this area. However, specific biological activities and safety profiles would require further investigation through experimental studies.

Formula: C₁₃H₁₉N₃O

InChI: InChI=1/C13H19N3O/c1-10-9-12(3-4-13(10)14)16-7-5-15(6-8-16)11(2)17/h3-4,9H,5-8,14H2,1-2H3

SMILES: Cc1cc(ccc1N)N1CCN(CC1)C(=O)C

Synonyms:

• 1-[4-(4-Amino-3-methylphenyl)piperazin-1-yl]ethanone
• Ethanone, 1-[4-(4-Amino-3-Methylphenyl)-1-Piperazinyl]-