CAS 862695-75-8

6-Chloro-2-cyclopropyl-3-pyridinecarboxylic acid

Description:

6-Chloro-2-cyclopropyl-3-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro substituent at the 6-position and a cyclopropyl group at the 2-position contributes to its unique reactivity and potential biological activity. This compound features a carboxylic acid functional group, which imparts acidic properties and can participate in various chemical reactions, such as esterification and amidation. The cyclopropyl group can influence the compound's steric and electronic properties, potentially affecting its interaction with biological targets. Additionally, the compound may exhibit specific solubility characteristics, depending on the solvent used, and could be of interest in medicinal chemistry for its potential pharmacological applications. Overall, 6-Chloro-2-cyclopropyl-3-pyridinecarboxylic acid represents a versatile structure that may serve as a lead compound in drug discovery or as an intermediate in organic synthesis.

Formula: C₉H₈ClNO₂

InChI: InChI=1S/C9H8ClNO2/c10-7-4-3-6(9(12)13)8(11-7)5-1-2-5/h3-5H,1-2H2,(H,12,13)

InChI key: InChIKey=FZPUPGGRIJXKTC-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(N=C(Cl)C=C1)C2CC2

Synonyms:

• 6-Chloro-2-cyclopropyl-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 6-chloro-2-cyclopropyl-
• 6-Chloro-2-cyclopropylnicotinic acid

3-Pyridinecarboxylic acid, 6-chloro-2-cyclopropyl-

CAS: 862695-75-8

Formula: C₉H₈ClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 197.6183

Ref: IN-DA00IDZK

6-Chloro-2-cyclopropylnicotinic acid

CAS: 862695-75-8

6-Chloro-2-cyclopropylnicotinic acid

Purity: 98%

Ref: 54-OR1036837

6-Chloro-2-cyclopropylnicotinic acid

CAS: 862695-75-8

6-Chloro-2-cyclopropylnicotinic acid is a clear, colorless liquid that is soluble in organic solvents. It has a molecular weight of 174.9 and an empirical formula of C8H7ClN2O2. This compound is used as a reagent, intermediate, or building block in organic synthesis and can be used in the production of pharmaceuticals. It is also useful as a building block for drug discovery and can be used to produce various other compounds with biological activity, such as 4-chloro-1-(4-nitrophenyl)piperidine. 6-Chloro-2-cyclopropylnicotinic acid is described by CAS number 862695-75-8 and has the chemical name 6-(chloromethyl) 2-(cyclopropyl) nicotinic acid.

Formula: C₉H₈ClNO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 197.62 g/mol

Ref: 3D-FC141188

6-Chloro-2-cyclopropylnicotinic acid

CAS: 862695-75-8

Formula: C₉H₈ClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 197.62

Ref: 10-F321028