CAS 862700-39-8

Carbamic acid, [(1R,3R)-3-(hydroxymethyl)cyclopentyl]-, 1,1-dimethylethyl ester, rel-

Description:

Carbamic acid, [(1R,3R)-3-(hydroxymethyl)cyclopentyl]-, 1,1-dimethylethyl ester, rel- (CAS 862700-39-8) is an organic compound characterized by its carbamate functional group, which is derived from carbamic acid. This compound features a cyclopentyl structure with a hydroxymethyl substituent, contributing to its unique stereochemistry and potential biological activity. The presence of the tert-butyl ester group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The stereochemistry indicated by the (1R,3R) configuration suggests specific spatial arrangements that can affect the compound's interaction with biological targets, potentially leading to specific pharmacological effects. As a carbamate, it may exhibit properties typical of this class, such as being a substrate for enzymatic hydrolysis or acting as an inhibitor of certain enzymes. Overall, the compound's characteristics, including its molecular structure and functional groups, suggest potential applications in medicinal chemistry and agrochemicals, although specific biological activities would require further investigation.

Formula: C₁₁H₂₁NO₃

InChI: InChI=1/C11H21NO3/c1-11(2,3)15-10(14)12-9-5-4-8(6-9)7-13/h8-9,13H,4-7H2,1-3H3,(H,12,14)/t8-,9-/s2

InChI key: InChIKey=VZZBOERLWPQMCJ-MDWBIBFBNA-N

SMILES: N(C(OC(C)(C)C)=O)[C@H]1C[C@H](CO)CC1

Synonyms:

• Carbamic acid, [(1R,3R)-3-(hydroxymethyl)cyclopentyl]-, 1,1-dimethylethyl ester, rel-

rel-tert-Butyl N-[(1R,3R)-3-(hydroxymethyl)cyclopentyl]carbamate

CAS: 862700-39-8

rel-tert-Butyl N-[(1R,3R)-3-(hydroxymethyl)cyclopentyl]carbamate

Purity: 95%

Molecular weight: 215.29g/mol

Ref: 54-OR1071472