CAS 86271-56-9
:(6Z)-2-amino-6-imino-5-(2-phenylhydrazino)pyridin-3(6H)-one
Description:
The chemical substance known as (6Z)-2-amino-6-imino-5-(2-phenylhydrazino)pyridin-3(6H)-one, with the CAS number 86271-56-9, is a heterocyclic compound featuring a pyridine ring. This compound is characterized by the presence of an amino group and an imino group, which contribute to its reactivity and potential biological activity. The phenylhydrazino substituent enhances its structural complexity and may influence its interactions with biological targets. Typically, such compounds can exhibit various pharmacological properties, including antimicrobial or antitumor activities, due to their ability to form hydrogen bonds and interact with biological macromolecules. The specific stereochemistry indicated by the "(6Z)" notation suggests a particular geometric configuration that can affect the compound's properties and reactivity. Additionally, the presence of nitrogen atoms in the structure may contribute to its solubility and stability in different environments. Overall, this compound represents a class of organic molecules that are of interest in medicinal chemistry and drug development.
Formula:C11H11N5O
InChI:InChI=1/C11H11N5O/c12-10-8(6-9(17)11(13)14-10)16-15-7-4-2-1-3-5-7/h1-6,15-16H,(H3,12,13,14)
SMILES:c1ccc(cc1)NNC1=CC(=O)C(=NC1=N)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,6-Diamino-5-hydroxy-3-(phenylazo)pyridine
CAS:Controlled ProductApplications A novel metabolite of Phenazopyridine (P313751).
References Bailey, K., et al.: Drug Metab. Dispos., 11, 277 (1983), Thomas, B. H., et al.: J. Pharm. Sci., 79, 321 (1990), Thomas, B.H., et al.: Xenobiotica, 23, 99 (1993),Formula:C11H11N5OColor and Shape:NeatMolecular weight:229.242,6-Diamino-5-hydroxy-3-(phenylazo)pyridine
CAS:2,6-Diamino-5-hydroxy-3-(phenylazo)pyridine is a versatile chemical substance that has various applications in different industries. It can be used as a dianhydride to create high-performance polymers or as an electrode material for batteries and fuel cells. This compound is also used in the production of lacosamide, a medication used to treat epilepsy. In addition to its industrial uses, 2,6-Diamino-5-hydroxy-3-(phenylazo)pyridine is also utilized in research laboratories as a reagent or marker. It is commonly used in aerosol compositions for testing purposes and in the analysis of toxicological samples. Researchers also rely on this compound for dispersive solid-phase extraction techniques and for studying photodegradation processes. Furthermore, 2,6-Diamino-5-hydroxy-3-(phenylazo)pyridine has shown potential in the development of polymeric compositions withFormula:C11H11N5OPurity:Min. 95%Molecular weight:229.24 g/mol

