CymitQuimica logo

CAS 862718-69-2

:

3-(2-Thienyl)piperidine

Description:
3-(2-Thienyl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring substituted with a thienyl group. The thienyl moiety, derived from thiophene, contributes to the compound's aromatic properties and potential reactivity. This compound typically exhibits a moderate to high polarity due to the presence of the nitrogen atom in the piperidine ring, which can participate in hydrogen bonding. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the piperidine structure is commonly found in various bioactive compounds. The compound may also display interesting electronic properties due to the conjugation between the thienyl and piperidine components. Its solubility can vary depending on the solvent, and it may exhibit specific interactions with biological targets, making it a subject of interest in drug design and development. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C9H13NS
InChI:InChI=1S/C9H13NS/c1-3-8(7-10-5-1)9-4-2-6-11-9/h2,4,6,8,10H,1,3,5,7H2
InChI key:InChIKey=ZRTROWVOYFUWEZ-UHFFFAOYSA-N
SMILES:C1(=CC=CS1)C2CCCNC2
Synonyms:
  • 3-(2-Thienyl)piperidine
  • Piperidine, 3-(2-thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.