CAS 862718-71-6
:3-Phenyl-1-piperidineethanamine
Description:
3-Phenyl-1-piperidineethanamine, also known by its CAS number 862718-71-6, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a phenyl group attached to the piperidine, contributing to its aromatic properties. The presence of the ethylamine side chain enhances its potential for biological activity, making it of interest in medicinal chemistry. Typically, compounds of this nature may exhibit properties such as being a potential ligand for various receptors or enzymes, and they may possess psychoactive effects depending on their specific structure and substituents. The molecular structure suggests that it could engage in hydrogen bonding and hydrophobic interactions, influencing its solubility and reactivity. Additionally, the compound's characteristics, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. Overall, 3-Phenyl-1-piperidineethanamine is a compound with potential applications in pharmacology and organic synthesis.
Formula:C13H20N2
InChI:InChI=1S/C13H20N2/c14-8-10-15-9-4-7-13(11-15)12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11,14H2
InChI key:InChIKey=LDLWTHMIKGPNCU-UHFFFAOYSA-N
SMILES:C(CN)N1CC(CCC1)C2=CC=CC=C2
Synonyms:- 1-Piperidineethanamine, 3-phenyl-
- 2-(3-Phenyl-piperidin-1-yl)-ethylamine
- 2-(3-Phenylpiperidin-1-yl)ethan-1-amine
- 3-Phenyl-1-piperidineethanamine
- 2-(3-Phenylpiperidin-1-yl)ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.