CymitQuimica logo

CAS 862728-35-6

:

3-Amino-5-bromo-2-hydroxybenzonitrile

Description:
3-Amino-5-bromo-2-hydroxybenzonitrile, with the CAS number 862728-35-6, is an organic compound characterized by the presence of an amino group (-NH2), a bromo substituent (-Br), and a hydroxy group (-OH) on a benzene ring that is also attached to a nitrile group (-C≡N). This compound typically exhibits properties associated with aromatic compounds, including stability and reactivity due to the electron-withdrawing nature of the nitrile group and the electron-donating effects of the amino group. The presence of the hydroxy group contributes to its potential solubility in polar solvents and may influence its reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the bromine atom can serve as a site for further functionalization. Overall, this compound may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, owing to its diverse functional groups that can participate in various chemical transformations.
Formula:C7H5BrN2O
InChI:InChI=1S/C7H5BrN2O/c8-5-1-4(3-9)7(11)6(10)2-5/h1-2,11H,10H2
InChI key:InChIKey=ACSSMNVQNSSHKN-UHFFFAOYSA-N
SMILES:C(#N)C1=C(O)C(N)=CC(Br)=C1
Synonyms:
  • Benzonitrile, 3-amino-5-bromo-2-hydroxy-
  • 3-Amino-5-bromo-2-hydroxybenzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.